Fiveable

📈AP Pre-Calculus Unit 3 Review

QR code for AP Pre-Calculus practice questions

3.12 Equivalent Representations of Trigonometric Functions

📈AP Pre-Calculus
Unit 3 Review

3.12 Equivalent Representations of Trigonometric Functions

Written by the Fiveable Content Team • Last updated September 2025
Verified for the 2026 exam
Verified for the 2026 examWritten by the Fiveable Content Team • Last updated September 2025

Trigonometric identities are equations that are true for all values of the variables in trigonometric equations, and they can be used to simplify trigonometric expressions. In this study guide, we will be exploring these identities and learning how to use them to solve problems. By the end of this guide, you will have a solid understanding of trigonometric identities and be able to apply them to solve a wide variety of problems.

The Pythagorean Identity

The Pythagorean identity is a fundamental trigonometric identity that states that the sum of the squares of the sine and cosine of an angle is equal to one. The identity is usually written as:

sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1

This identity can be derived from the fact that in a right triangle, the square of the length of the hypotenuse (the side opposite the right angle) is equal to the sum of the squares of the lengths of the other two sides. The trigonometric functions sine and cosine are defined based on the ratios of the sides of the right triangle, so the Pythagorean identity can be used to relate these functions to each other.

This identity can be used to prove other trigonometric identities, such as

cos2(x)=1sin2(x)cos^2(x) = 1 - sin^2(x)

and

sin2(x)=1cos2(x)sin^2(x) = 1 - cos^2(x)

It can also be used to simplify trigonometric expressions and solve trigonometric equations. Below is an example of how to simplify a trig expression using the Pythagorean identity.

Simplify the expression: 2sin2(x)+2cos2(x)12sin^2(x) + 2cos^2(x) - 1

  1. Use the Pythagorean identity (sin2(x)+cos2(x)=1)(sin^2(x) + cos^2(x) = 1) to rewrite the expression as: 2(sin2(x)+cos2(x))12(sin^2(x) + cos^2(x)) - 1

  2. Substitute the Pythagorean identity into the expression to get: 2(1) - 1

  3. Simplify the expression by performing the arithmetic: 2 - 1 = 1

Our final answer is 1. It's important to practice these kinds of problems so that you become comfortable using trigonometric identities to simplify expressions and solve problems. With enough practice, you'll be able to simplify even the most complex expressions quickly and easily.

Pep mascot
more resources to help you study

More Pythagorean Identities

The Pythagorean identity can be algebraically manipulated in different ways to establish other trigonometric relationships. One example is the relationship between the tangent and secant functions, which is given by the identity:

tan2θ=sec2θ1\tan^2\theta = \sec^2\theta - 1

This identity can be derived by using the definitions of the tangent and secant functions, which are:

tan(x)=sin(x)/cos(x)tan(x) = sin(x)/cos(x)

sec(x)=1/cos(x)sec(x) = 1/cos(x)

By squaring the tangent function and substituting the definition of the secant function, we get:

tan2(x)=(sin(x)/cos(x))2tan^2(x) = (sin(x)/cos(x))^2 =(sin(x))2/(cos(x))2= (sin(x))^2 / (cos(x))^2

Using the Pythagorean identity (sin2(x)+cos2(x)=1)(sin^2(x) + cos^2(x) = 1), we have:

tan2(x)=(1cos2(x))/cos2(x)tan^2(x) = (1 - cos^2(x)) / cos^2(x)

=1/cos2(x)1= 1/cos^2(x) - 1

=sec2(x)1= sec^2(x) - 1

Therefore, tan2(x)=sec2(x)1tan^2(x) = sec^2(x) - 1.


Our last Pythagorean identity is:

arcsinx=arccos1x2\arcsin x = \arccos \sqrt{1-x^2}

This identity can be derived by using the definitions of the sine and cosine functions, which are:

sin(x)=yandcos(x)=sqrt(1x2)sin(x) = y and cos(x) = sqrt(1 - x^2)

If we know one of them (x)(x) we can find the value of the expression by using arcsin or arccos, but we can also find xx by using arccos(sqrt(1x2))=arcsin(x)arccos(sqrt(1 - x^2)) = arcsin(x). This is the identity explained above.

It's important to note that these identities have appropriate domain restrictions. For example, the tangent and secant functions are not defined for x=𝛑/2+n𝛑x = 𝛑/2 + n𝛑, where n is an integer, because the denominator of the tangent function is zero in these cases. Similarly, the arcsine and arccosine functions are defined only for xx in the range [-1,1].

The Sum Identities

The two sum identities for trigonometric functions, also known as the angle addition formulas, are used to find the trigonometric values of the sum of two angles in terms of the trigonometric values of the individual angles. The two sum identities are:

1. Sine Sum Identity: 

sin(α+β)=sinαcosβ+cosαsinβ\sin(\alpha + \beta) = \sin \alpha \cos \beta + \cos \alpha \sin \beta

2. Cosine Sum Identity: 

cos(α+β)=cosαcosβsinαsinβ\cos(\alpha + \beta) = \cos \alpha \cos \beta - \sin \alpha \sin \beta

In these identities, the Greek letters alpha (α) and beta (β) represent the two angles being added together. In the following explanation, we will be using the letters a and b to represent alpha and beta, respectively.

Here's an example of using the sine sum identity to solve a problem:

Example: Find the value of sin(15+30)sin(15 + 30)

We can use the sine sum identity to find the value of sin(15+30)sin(15 + 30) in terms of the values of sin(15)sin(15) and sin(30)sin(30). The sine sum identity is:

sin(a+b)=sin(a)cos(b)+cos(a)sin(b)sin(a + b) = sin(a)cos(b) + cos(a)sin(b)

We know that sin(15)=0.2588sin(15) = 0.2588 and sin(30)=0.5sin(30) = 0.5, so we can substitute these values into the sine sum identity:

sin(15+30)=sin(15)cos(30)+cos(15)sin(30)sin(15 + 30) = sin(15)cos(30) + cos(15)sin(30)

And now we can simplify the expression using the values of sin(15)sin(15) and sin(30)sin(30) that we know:

sin(15+30)=0.25880.8660+0.96590.5sin(15 + 30) = 0.2588 * 0.8660 + 0.9659 * 0.5

We can use a calculator to get the final value of the expression:

sin(15+30)=0.766sin(15 + 30) = 0.766

So the value of sin(15+30)sin(15 + 30) is approximately 0.766.

You can use the same approach to solve other problems using the sum identities, but make sure to use the appropriate identity for the function you are working with (sine or cosine) and to use the correct values for the angles. It's also worth mentioning that for many trigonometry problems, you have to make sure to consider the domain of the trigonometric functions, as the sum identities are only true for a specific range of angles.

The Difference and Double-Angle Identities

The difference and double-angle identities are trigonometric identities that allow you to find the values of trigonometric functions for the difference and double of an angle, respectively, in terms of the value of the function for the original angle.

  1. Difference Identities: sin(ab)=sin(a)cos(b)cos(a)sin(b)cos(ab)=cos(a)cos(b)+sin(a)sin(b)sin(a - b) = sin(a)cos(b) - cos(a)sin(b)cos(a - b) = cos(a)cos(b) + sin(a)sin(b)

These identities can be used to simplify trigonometric expressions, solve trigonometric equations, and find the values of trigonometric functions for the difference of two angles. For example, if we know the value of sin(a)sin(a) and cos(a)cos(a), we can use the difference identity to find the value of sin(ab)sin(a - b) in terms of sin(b) and cos(b).

  1. Double Angle Identities: sin(2a)=2sin(a)cos(a)cos(2a)=cos2(a)sin2(a)=12sin2(a)=2cos2(a)1sin(2a) = 2sin(a)cos(a)cos(2a) = cos^2(a) - sin^2(a) = 1 - 2sin^2(a) = 2cos^2(a) - 1

These identities can be used to solve trigonometric equations involving double of an angle. For example, if we know the value of sin(a)sin(a) and cos(a)cos(a), we can use the double angle identity to find the value of sin(2a)sin(2a) or cos(2a)cos(2a).

Practice Problems

1. What is the value of sin(2x30)sin(2x - 30) if sin(x)=0.4sin(x) = 0.4 and cos(x)=0.9?cos(x) = 0.9?

a) 0.76

b) 0.24

c) -0.24

d) -0.76


Answer: c) -0.24

2. Simplify tan(2x)ifsin(x)=0.6tan(2x) if sin(x) = 0.6 and cos(x)=0.8cos(x) = 0.8 a) 0.75 b) 1.5 c) 2.0 d) 3.0


Answer: b) 1.5

3. Simplify cos(a+b)cos(ab)cos(a + b) - cos(a - b)

a) 2sin(a)sin(b)2sin(a)sin(b) b) 2cos(a)cos(b)2cos(a)cos(b) c) sin(a+b)sin(ab)sin(a+b) - sin(a-b)

d) cos(a+b)+cos(ab)cos(a+b) + cos(a-b)


Answer: a) 2sin(a)sin(b)2sin(a)sin(b)

Vocabulary

The following words are mentioned explicitly in the College Board Course and Exam Description for this topic.

TermDefinition
algebraic manipulationThe process of rewriting expressions using algebraic operations to transform them into equivalent forms.
cosine sum identityThe trigonometric identity cos(α + β) = cos α cos β - sin α sin β, which expresses the cosine of a sum of two angles.
difference identitiesTrigonometric identities derived from sum identities by substituting negative angles, used to express trigonometric functions of angle differences.
domain restrictionsLimitations on the input values of a function based on mathematical validity, contextual meaning, or extreme values in the data set.
double-angle identitiesTrigonometric identities that express trigonometric functions of twice an angle in terms of functions of the original angle.
equivalent analytic representationsDifferent algebraic forms of trigonometric expressions that are mathematically equal and can reveal different properties or simplify problem-solving.
equivalent formsDifferent ways of writing the same mathematical expression that have equal values for all valid inputs.
Pythagorean identityThe fundamental trigonometric identity sin² θ + cos² θ = 1, derived from the Pythagorean Theorem applied to the unit circle.
sine sum identityThe trigonometric identity sin(α + β) = sin α cos β + cos α sin β, which expresses the sine of a sum of two angles.
trigonometric equationsEquations that contain trigonometric functions and require finding the values of the variable that satisfy the equation.
trigonometric expressionsMathematical expressions involving trigonometric functions such as sine, cosine, tangent, and their reciprocals.
trigonometric identityAn equation involving trigonometric functions that is true for all values in the domain of the functions.
trigonometric inequalitiesInequalities that contain trigonometric functions and require finding the values of the variable that satisfy the inequality.
unit circleA circle with radius 1 centered at the origin, used to define trigonometric functions where a point on the circle has coordinates (cos θ, sin θ).

Frequently Asked Questions

How do I use the Pythagorean identity sin²θ + cos²θ = 1 to solve problems?

Use the identity as an algebra tool: sin²θ + cos²θ = 1 lets you replace one trig square with 1 minus the other so problems become simple algebra. How to use it (short recipe) - If you know sin θ (or sin²θ), get cos²θ = 1 − sin²θ. Then cos θ = ±√(1 − sin²θ). Pick the sign from the angle’s quadrant. - Example: sin θ = 3/5 and θ in QI → cos θ = +√(1 − 9/25) = +4/5. - If you know cos θ, same idea: sin θ = ±√(1 − cos²θ). - For equations: convert everything to sin or cos, get a polynomial in that function, solve, then check quadrant/sign and full-angle solutions (add 2πn or use symmetry). - Derived forms: divide by cos²θ to get tan²θ + 1 = sec²θ (or tan²θ = sec²θ − 1)—useful for rewriting/solving. AP exam tips: show algebraic steps, give exact values (no decimals unless asked), and include general solutions (θ = … + 2πn). For a focused review, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and practice lots of problems at (https://library.fiveable.me/practice/ap-pre-calculus).

What's the formula for sin(A + B) and cos(A + B)?

sin(A + B) = sin A cos B + cos A sin B cos(A + B) = cos A cos B − sin A sin B These are the angle-addition (sum) identities from the CED (3.12.B.1 and 3.12.B.2). You can use them to rewrite sums into products of sine and cosine, to derive difference identities (replace B with −B), double-angle formulas (set B = A), and to verify or solve trig equations (useful for Topic 3.12.C). Quick examples: - Difference: sin(A − B) = sin A cos B − cos A sin B - Double angle: cos(2A) = cos²A − sin²A (set B = A) On the AP Precalculus exam you’ll often use these in free-response parts that ask you to rewrite or solve trig expressions (see Topic 3.12 in the CED). For more review and worked examples, check the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and plenty of practice problems at (https://library.fiveable.me/practice/ap-pre-calculus).

When do I use sum identities vs difference identities in trig?

Use the identity that matches the angle form you have or want to create. If the angle inside the trig function is written as a sum, use the sum formulas: - sin(α+β) = sinα cosβ + cosα sinβ - cos(α+β) = cosα cosβ − sinα sinβ If the angle is a difference, use the difference versions (or treat β as −β and apply the sum formula): - sin(α−β) = sinα cosβ − cosα sinβ - cos(α−β) = cosα cosβ + sinα sinβ How to pick in practice: - If the problem gives something like sin(A)cos(B)+cos(A)sin(B), recognize it as sin(A+B) and rewrite it as a single sine (useful for simplifying or solving equations—CED 3.12.B, 3.12.C). - If you need to rewrite sin(x−π/6) or simplify an expression with a subtraction in the angle, use the difference identity directly. - For double angles (2α) or half-angles, use the special cases derived from sum/difference identities (CED 3.12.B.3). - When solving equations, pick the form that isolates the angle or produces a standard value (CED 3.12.C). For more worked examples and AP-style practice (this topic maps to 3.12), check the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and the Unit 3 overview (https://library.fiveable.me/ap-pre-calculus/unit-3). For lots of practice problems, go to (https://library.fiveable.me/practice/ap-pre-calculus).

I don't understand how to get tan²θ = sec²θ - 1 from the Pythagorean identity - can someone explain?

Start with the Pythagorean identity from the unit-circle: sin²θ + cos²θ = 1. Divide every term by cos²θ (you can do this as long as cos θ ≠ 0, since we can’t divide by zero). That gives (sin²θ)/(cos²θ) + (cos²θ)/(cos²θ) = 1/(cos²θ), which simplifies to tan²θ + 1 = sec²θ. Rearranging gives tan²θ = sec²θ − 1. Key notes: dividing by cos²θ introduces the domain restriction cos θ ≠ 0 (so tan and sec are defined). This algebraic manipulation is exactly the kind of equivalent form the CED expects you to produce in Topic 3.12 (useful for rewriting expressions and solving trig equations on the exam). For more practice and worked explanations, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and try problems at (https://library.fiveable.me/practice/ap-pre-calculus).

How do I verify trigonometric identities step by step?

Start with one side and rewrite it using only trusted identities until it matches the other side. Steps you can follow every time: 1. Pick the simpler side (or the side with fractions) to start. 2. Convert everything to sin and cos when helpful (CED 3.12.A & keywords: sin²θ+cos²θ=1). 3. Use Pythagorean identities (sin²+cos²=1, tan²=sec²−1) and angle-sum/difference formulas as needed (CED 3.12.B). 4. Get a common denominator, factor, or use algebraic manipulation to simplify. 5. Stop when you’ve shown it equals the other side. Don’t try to transform both sides at once unless you show equivalence steps. Always justify each rewrite with the identity you used. Quick example: verify sec²θ − tan²θ = 1 - sec²θ − tan²θ = (1/cos²θ) − (sin²θ/cos²θ) = (1 − sin²θ)/cos²θ = cos²θ/cos²θ = 1. Remember AP free-response rules: show each step clearly (your work is scored), and be comfortable converting to sin/cos and using sum identities (see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z)). For more practice, try problems at the unit page (https://library.fiveable.me/ap-pre-calculus/unit-3) or the practice bank (https://library.fiveable.me/practice/ap-pre-calculus).

What's the difference between sin(2θ) and 2sin(θ)?

They’re different functions. Use the double-angle identity (an angle-addition result from the CED): sin(2θ) = 2 sin θ cos θ. So sin(2θ) multiplies sin θ by cos θ as well—it’s a horizontal compression (period halved) because the angle is doubled. Meanwhile 2 sin θ is a vertical stretch of the original sine (amplitude doubled) with the same period. When are they equal? Solve 2 sin θ cos θ = 2 sin θ → 2 sin θ (cos θ − 1) = 0. So sin(2θ) = 2 sin θ exactly when sin θ = 0 or cos θ = 1, i.e. θ = πk (integers k). For most θ they’re not equal. Why this matters for AP: Topic 3.12.B expects you to use angle-sum/double-angle identities to rewrite and compare trig expressions (useful on FRQ 4 and modeling questions). For a quick review, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and try practice problems (https://library.fiveable.me/practice/ap-pre-calculus).

How do I solve trigonometric equations when they have multiple angles?

Short answer: treat the “multiple angle” like any trig equation—rewrite using identities, isolate a single trig of one angle, solve for that angle, then divide by the multiplier to get x and add the correct periodic term. Steps (with an example): 1. Use equivalent forms from the CED (double-angle, sum/difference, Pythagorean) to simplify. Example: sin(2x) = √3/2. (You used the double-angle function already.) 2. Solve for the inner angle: 2x = π/3 + 2πk or 2x = 2π/3 + 2πk (reference angles). 3. Divide by the multiplier: x = π/6 + πk or x = π/3 + πk, k ∈ Z. That division changes the period from 2π to 2π/2 = π, so add πk. 4. Check domain restrictions (e.g., 0 ≤ x < 2π) and convert to radian mode on the exam calculator when needed. Tip: if you get expressions like cos(3x) or sin(x/2), the general solution adds 2π/(coefficient)·k. For more worked examples and AP-aligned practice, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and try extra problems at (https://library.fiveable.me/practice/ap-pre-calculus).

Can someone explain how arcsin x = arccos(√(1-x²)) works and when I can use it?

Start with the unit-circle/Pythagorean idea: if θ is an angle with sin θ = x, then cos²θ = 1 − sin²θ = 1 − x², so cos θ = ±√(1 − x²). Inverse functions force you to pick the principal (range) values: - arcsin x returns θ in [−π/2, π/2] such that sin θ = x. - arccos t returns an angle in [0, π] whose cosine is t. If you want arcsin x = arccos(√(1−x²)) then both sides must represent the same principal angle θ. That requires cos θ = +√(1−x²) and θ ≥ 0 (because arccos of a nonnegative number lies in [0, π/2]). So the identity holds for x in [0, 1]. Example checks: x = 1 → π/2 = arccos(0); x = 0 → 0 = arccos(1). For x < 0 arcsin x is negative but arccos(√(1−x²)) is nonnegative, so they differ. This is an application of the Pythagorean identity and cofunction relationships in the AP CED (Topic 3.12). For more review and practice, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and the unit page (https://library.fiveable.me/ap-pre-calculus/unit-3).

I'm confused about domain restrictions when using inverse trig identities - what do I need to watch out for?

Main things to watch for with inverse trig identities: - Domain of the input: inverse trig functions only accept values in [−1,1]. Any algebraic step that introduces sin² or cos² → √(1 − x²) requires checking that x is in [−1,1] first. - Principal ranges (so outputs match what the inverse returns): arcsin(x) ∈ [−π/2, π/2], arccos(x) ∈ [0, π], arctan(x) ∈ (−π/2, π/2). Use these when you rewrite expressions (e.g., arcsin x = π/2 − arccos x is always valid), but formulas that replace a trig value by a square root (√(1 − x²)) need a sign choice. - Sign/ quadrant issues: replacing sin θ by ±√(1 − cos²θ) requires knowing θ’s quadrant (or the sign of sin θ). If you drop the ±, you can lose solutions or introduce extraneous ones. Always check which sign is appropriate. - When solving equations, restrict the domain before applying inverses and always check solutions back in the original equation (AP FRQs expect justification). On the AP calculator sections use radian mode unless the problem says degrees. For a focused review, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and more unit resources (https://library.fiveable.me/ap-pre-calculus/unit-3). For lots of practice problems, try Fiveable’s practice page (https://library.fiveable.me/practice/ap-pre-calculus).

When should I convert everything to sine and cosine vs using other trig identities?

Short answer: convert to sine and cosine when doing algebraic simplification or using the Pythagorean identity; use sum/difference, double-angle, or cofunction identities when the expression includes sums/differences of angles or you need a specific form for solving or modeling. When to convert to sin & cos (good moves) - You have tan, cot, sec, csc, or their powers and want algebraic manipulation (use tan = sin/cos, sec = 1/cos, etc.) so you can apply sin²θ+cos²θ=1 or cancel factors. - You need to use Pythagorean rearrangements (e.g., tan²θ = sec²θ − 1) to solve or restrict domains. - You’re verifying an identity algebraically—rewriting everything in sin and cos often makes cancellations transparent. When to use sum/difference or other named identities - You see sin(α±β) or cos(α±β) or need to expand/condense products like sinA cosB. - You’re given angle relationships (α+β, double/half angles) or need a particular phase shift for modeling sinusoidal behavior—use angle-sum, double-angle, half-angle, or cofunction identities. - For solving equations where an angle shift makes values obvious (reference angles), prefer sum/difference forms. Strategy on problems (AP-aligned) 1. Ask: am I simplifying/algebraic (convert to sin/cos) or manipulating angles/phase (use angle identities)? 2. Convert only as far as needed—avoid extra algebra that hides structure. 3. Always note domain restrictions when you divide by cos or use inverse functions (AP free-response often requires showing work and domain reasoning). For worked examples and practice, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and try extra problems at Fiveable Practice (https://library.fiveable.me/practice/ap-pre-calculus).

How do I know which equivalent form of a trig expression to use when solving equations?

Pick the form that makes the missing info or algebra easiest to handle. - If you see sec, csc, or tan, rewrite in sin/cos (e.g., sec x = 1/cos x, tan = sin/cos) so you can clear denominators or use sin²+cos²=1. Pythagorean forms (sin²+cos²=1 → tan²=sec²−1, etc.) help remove squares or convert between functions. - If the equation has sums or phase shifts (sin(α±β), cos(α±β)), expand with angle-sum identities to isolate basic sin/cos terms or to factor. - Use double-angle/half-angle when you need to turn cos(2x) into 1−2sin²x or 2cos²x−1 to solve quadratics in sin or cos. - Always check domain/restrictions after algebra (divide by zero, range limits). For AP free-response remember to show steps and give exact values when possible (no calculator for some parts). For worked examples and quick refreshers, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and practice problems (https://library.fiveable.me/practice/ap-pre-calculus).

What are the double angle formulas and how do I derive them from sum identities?

Start from the sum identities in the CED: sin(α+β) = sinα cosβ + cosα sinβ and cos(α+β) = cosα cosβ − sinα sinβ. Put β = α to get the double-angle formulas: - sin(2α) = sin(α+α) = sinα cosα + cosα sinα = 2 sinα cosα. - cos(2α) = cos(α+α) = cosα cosα − sinα sinα = cos^2α − sin^2α. Use the Pythagorean identity sin^2α + cos^2α = 1 to rewrite cos(2α) in other useful forms: - cos(2α) = 1 − 2 sin^2α (replace cos^2α by 1 − sin^2α), - cos(2α) = 2 cos^2α − 1 (replace sin^2α by 1 − cos^2α). From tan(α+β) = (tanα + tanβ)/(1 − tanα tanβ) with β = α you get: - tan(2α) = (2 tanα)/(1 − tan^2α), valid where denominators ≠ 0. Why it matters for AP Precalc: these give equivalent forms (CED 3.12.B.3) you’ll use to rewrite expressions, solve trig equations, and simplify models on the exam. For extra practice and examples, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) or the unit page (https://library.fiveable.me/ap-pre-calculus/unit-3).

I keep messing up the signs in cos(A + B) = cos A cos B - sin A sin B - any tips to remember?

Short trick: remember “cos–cos minus sin–sin”—cos(A + B) = cos A·cos B − sin A·sin B. Say it out loud: “cos cos minus sin sin.” Another helpful cue: think of cosine as the x-coordinate (even function) and sine as the y-coordinate (odd). Adding angles corresponds to rotating twice; the x-component comes from x·x minus y·y, so the sign for the sin·sin term is negative. Quick check using the difference identity: cos(A − B) = cos A·cos B + sin A·sin B. The only change is the sign between the two products—so adding flips the sign. You can also derive it from the unit circle or Euler’s formula if you like a proof. These sum/difference identities are in Topic 3.12 of the CED (useful for double-angle and solving trig equations). For targeted review and practice, see the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and grab extra problems at (https://library.fiveable.me/practice/ap-pre-calculus).

How do I use trig identities to simplify expressions before solving equations?

Start by rewriting everything in simpler, common forms so the equation is easier to solve. Steps you’ll use from the CED (3.12): - Convert to sin and cos using definitions (tan = sin/cos, sec = 1/cos). That keeps one trig function (3.12.A). - Use Pythagorean identities to replace squared terms: sin^2θ + cos^2θ = 1 → rewrite sin^2 or cos^2, or use tan^2θ = sec^2θ − 1 when you have tan/sec (3.12.A.2). - Use angle-sum/difference or double-angle identities to combine terms like sin(α+β) or cos(2θ) (3.12.B). - Factor or substitute (set u = cos θ or u = tan θ) to turn it into an algebraic equation you can solve (3.12.C). Also watch domain restrictions from the original expressions (can't divide by zero, ranges for arcs). On the AP, show each identity step and justify substitutions. For targeted review and worked examples, check the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and practice problems (https://library.fiveable.me/practice/ap-pre-calculus).

Why does my calculator give me a different answer than the exact form when I'm working with inverse trig functions?

Your calculator often gives a different value because inverse trig functions have principal ranges and your algebraic “exact” form can represent a different angle (same sine/cosine) outside that principal range. Key points: - Principal values: arcsin(x) returns values in [−π/2, π/2], arccos(x) in [0, π]. So arcsin(1/2) = π/6 but arccos(1/2) = π/3—both correct, different principal angles. Cofunction identities (like arcsin x = arccos(√(1−x²))) need sign/domain care. - Reference angles & periodicity: sin θ = sin(π−θ), so an “exact” answer like θ = π/6 isn’t the only solution; calculators give the principal one. - Mode and rounding: make sure your calculator is in radian mode for the AP exam (CED requires radian mode for calculator parts). Also calculators may show decimals (rounded) instead of exact symbolic forms. - Algebraic manipulations must track domain/signs (use Pythagorean identity carefully: tan²θ = sec²θ−1 etc.). For AP-style practice and reminders on cofunction/domain reasoning, check the Topic 3.12 study guide (https://library.fiveable.me/ap-pre-calculus/unit-3/equivalent-representations-trigonometric-functions/study-guide/ElEOcRdfZByN7kekt68Z) and get extra practice problems at (https://library.fiveable.me/practice/ap-pre-calculus).