Enthalpy and are key concepts in thermochemistry, helping us understand heat flow in chemical reactions. They're essential for predicting reaction spontaneity and calculating energy changes, connecting the microscopic world of molecules to macroscopic heat effects we can measure.

These tools let us figure out tricky reaction energies by breaking them into simpler steps. This ties into the broader theme of energy conservation and transformation in chemical processes, a cornerstone of thermodynamics and real-world applications in energy science.

Enthalpy in Thermochemistry

Definition and Significance of Enthalpy

Top images from around the web for Definition and Significance of Enthalpy
Top images from around the web for Definition and Significance of Enthalpy
  • Enthalpy is a thermodynamic state function represented by the symbol H, which is the sum of the internal energy of a system plus the product of its pressure and volume (H=U+PVH = U + PV)
  • Enthalpy measures the total heat content of a system at constant pressure
  • Changes in enthalpy (ΔHΔH) represent the heat absorbed or released by a system during a chemical reaction or physical process
  • The of a reaction helps determine the heat exchanged between a system and its surroundings, as well as the spontaneity and direction of chemical reactions

Types of Enthalpy Changes

  • Exothermic reactions have a negative enthalpy change (ΔH<0ΔH < 0) indicating heat is released from the system to the surroundings (combustion of methane)
  • Endothermic reactions have a positive enthalpy change (ΔH>0ΔH > 0) indicating heat is absorbed by the system from the surroundings (photosynthesis)
  • (ΔH°fΔH°f) is the enthalpy change that occurs when one mole of a compound is formed from its constituent elements in their standard states at a specified temperature (usually 298 K) and 1 atm pressure
  • By convention, the standard enthalpy of formation for any element in its most stable form at 1 atm and the specified temperature is zero (graphite for carbon, diatomic molecules for gases like H2H_2 and O2O_2)

Calculating Enthalpy Changes

Using Standard Enthalpy of Formation

  • The standard enthalpy of reaction (ΔH°rxnΔH°rxn) can be calculated using the standard enthalpies of formation of the reactants and products according to the equation: ΔH°rxn=Σ(n×ΔH°f(products))Σ(n×ΔH°f(reactants))ΔH°rxn = Σ(n × ΔH°f (products)) - Σ(n × ΔH°f (reactants)), where n is the stoichiometric coefficient of each species
  • To calculate the enthalpy change for a reaction, multiply the standard enthalpy of formation of each product by its stoichiometric coefficient and sum these values, then subtract the sum of the standard enthalpies of formation of the reactants multiplied by their stoichiometric coefficients
  • Example: For the reaction CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) → CO_2(g) + 2H_2O(l), ΔH°rxn=[ΔH°f(CO2)+2ΔH°f(H2O)][ΔH°f(CH4)+2ΔH°f(O2)]ΔH°rxn = [ΔH°f(CO_2) + 2ΔH°f(H_2O)] - [ΔH°f(CH_4) + 2ΔH°f(O_2)]

Using Hess's Law

  • Hess's Law states that the total enthalpy change for a chemical reaction is independent of the pathway or the number of steps taken to reach the final products, as long as the initial and final states are the same
  • Hess's Law is a consequence of the conservation of energy and the state function nature of enthalpy, which means that the enthalpy change of a reaction depends only on the initial and final states of the system, not on the path taken between these states
  • To apply Hess's Law, combine the known enthalpy changes of related reactions to determine the enthalpy change of the target reaction by reversing reactions, multiplying reactions by a factor, and/or adding reactions together
  • When reversing a reaction, the sign of the enthalpy change is also reversed; when multiplying a reaction by a factor, the enthalpy change is multiplied by the same factor; when adding reactions together, the enthalpy changes of the individual reactions are added together to give the overall enthalpy change

Hess's Law for Enthalpy

Applying Hess's Law

  • Identify the target reaction for which the enthalpy change is unknown
  • Find a series of known reactions that can be combined to yield the target reaction
  • Manipulate the known reactions by reversing, multiplying, or adding them together to obtain the target reaction
  • Calculate the enthalpy change of the target reaction by combining the enthalpy changes of the manipulated reactions according to the rules of Hess's Law

Example of Hess's Law Application

  • Target reaction: C(s)+2H2(g)CH4(g)C(s) + 2H_2(g) → CH_4(g)
  • Known reactions:
    1. C(s)+O2(g)CO2(g)C(s) + O_2(g) → CO_2(g), ΔH1=393.5kJ/molΔH_1 = -393.5 kJ/mol
    2. CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) → CO_2(g) + 2H_2O(l), ΔH2=890.4kJ/molΔH_2 = -890.4 kJ/mol
    3. H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) → H_2O(l), ΔH3=285.8kJ/molΔH_3 = -285.8 kJ/mol
  • Manipulate the known reactions:
    • Reverse reaction 1: CO2(g)C(s)+O2(g)CO_2(g) → C(s) + O_2(g), ΔH1=+393.5kJ/molΔH_1' = +393.5 kJ/mol
    • Keep reaction 2 as is
    • Multiply reaction 3 by 2: 2H2(g)+O2(g)2H2O(l)2H_2(g) + O_2(g) → 2H_2O(l), ΔH3=571.6kJ/molΔH_3' = -571.6 kJ/mol
  • Add the manipulated reactions: CO2(g)+2H2(g)+O2(g)C(s)+CH4(g)+2H2O(l)CO_2(g) + 2H_2(g) + O_2(g) → C(s) + CH_4(g) + 2H_2O(l), ΔH=ΔH1+ΔH2+ΔH3=1068.5kJ/molΔH = ΔH_1' + ΔH_2 + ΔH_3' = -1068.5 kJ/mol
  • The enthalpy change for the target reaction is 1068.5kJ/mol-1068.5 kJ/mol, indicating an exothermic process

Enthalpy Diagrams

Constructing Enthalpy Diagrams

  • An enthalpy diagram is a graphical representation of the enthalpy changes that occur during a series of reactions, with the enthalpy plotted on the vertical axis and the reaction progress on the horizontal axis
  • Reactants are typically placed at the top, and products are placed at the bottom; the vertical distance between the reactants and products represents the overall enthalpy change of the reaction (ΔHΔH)
  • Intermediate species or transition states may be included in the diagram, with their enthalpies plotted relative to the reactants and products; the enthalpy differences between these species represent the enthalpy changes for individual reaction steps
  • Exothermic reactions are represented by a downward step in the diagram, while endothermic reactions are represented by an upward step

Using Enthalpy Diagrams to Visualize Hess's Law

  • Enthalpy diagrams can be used to visualize Hess's Law, as the overall enthalpy change of a reaction is independent of the pathway taken
  • The sum of the individual steps in the diagram will equal the total enthalpy change
  • Example: The enthalpy diagram for the formation of methane (CH4CH_4) from its elements can be constructed using the known reactions from the previous Hess's Law example, demonstrating that the overall enthalpy change is the same regardless of the pathway taken

Bond Energies and Enthalpy Changes

Relationship Between Bond Energies and Enthalpy Changes

  • Bond energy is the amount of energy required to break a specific chemical bond in one mole of a substance in the gas phase, or conversely, the amount of energy released when a bond is formed
  • The enthalpy change of a reaction can be estimated using the bond energies of the reactants and products, as the overall enthalpy change is related to the difference between the energy required to break bonds in the reactants and the energy released when new bonds form in the products
  • To estimate the enthalpy change using bond energies, sum the bond energies of all the bonds broken in the reactants and subtract the sum of the bond energies of all the bonds formed in the products: ΔH=Σ(bondenergiesofbondsbroken)Σ(bondenergiesofbondsformed)ΔH = Σ(bond energies of bonds broken) - Σ(bond energies of bonds formed)

Limitations of the Bond Energy Approach

  • The bond energy method provides an approximation of the enthalpy change, as it assumes that the bond energies are independent of the molecular environment and that the energy required to break a bond is equal to the energy released when the same bond is formed
  • In reality, bond energies can vary slightly depending on the specific molecule and its structure
  • Comparing the calculated enthalpy change using bond energies with the experimental value can provide insights into the limitations of the bond energy approach and the factors that influence the actual enthalpy change of a reaction
  • Example: The enthalpy change for the combustion of methane (CH4+2O2CO2+2H2OCH_4 + 2O_2 → CO_2 + 2H_2O) calculated using bond energies may differ from the experimental value due to the assumptions made in the bond energy approach

Key Terms to Review (17)

Bond Enthalpy: Bond enthalpy is the amount of energy required to break one mole of a specific type of bond in a molecule, measured under standard conditions. It reflects the strength of a bond, where stronger bonds have higher bond enthalpies. Understanding bond enthalpy helps in predicting how much energy will be absorbed or released during chemical reactions, linking closely to concepts like internal energy and the overall enthalpy change in reactions.
Calorimetry: Calorimetry is the science of measuring heat transfer in physical and chemical processes. It involves determining the amount of energy absorbed or released during reactions or phase changes, providing essential insights into thermodynamics and energy changes. This method connects to various concepts including temperature measurement, heat capacity, reaction enthalpy, and entropy changes in reactions.
Confusion between heat and temperature: Confusion between heat and temperature arises when these two related but distinct concepts are not clearly understood. Heat refers to the energy transferred between systems due to a temperature difference, while temperature is a measure of the average kinetic energy of particles in a substance. This distinction is crucial in understanding thermodynamic processes, such as enthalpy changes during reactions and the application of Hess's Law.
Endothermic Reaction: An endothermic reaction is a chemical process that absorbs heat from its surroundings, resulting in a decrease in temperature in the immediate environment. These reactions often require energy input, typically in the form of heat, to proceed and can lead to changes in enthalpy, making them crucial for understanding energy transformations in chemical systems.
Enthalpy Change: Enthalpy change is the heat content change of a system at constant pressure, reflecting the amount of energy absorbed or released during a chemical reaction or physical transformation. This concept is crucial in understanding how energy flows in reactions, guiding principles like Hess's Law, which allows for the calculation of enthalpy changes for reactions that are difficult to measure directly. Additionally, it ties into bond energies and formation enthalpies, as well as the thermodynamics of electrochemical cells.
First Law of Thermodynamics: The First Law of Thermodynamics states that energy cannot be created or destroyed, only transformed from one form to another. This principle emphasizes the conservation of energy in all physical and chemical processes, influencing various fundamental concepts including heat, work, and the behavior of systems at the molecular level.
Gottfried Wilhelm Leibniz: Gottfried Wilhelm Leibniz was a prominent German philosopher, mathematician, and scientist in the 17th century, known for his contributions to calculus and metaphysics. His work laid the foundation for many concepts in physics and chemistry, influencing the understanding of energy, matter, and reactions, which are crucial for grasping enthalpy and Hess's Law.
Heat Capacity: Heat capacity is the amount of heat energy required to raise the temperature of a substance by one degree Celsius (or Kelvin). This concept is vital in understanding how substances interact with thermal energy and connects to ideas like thermal equilibrium and temperature measurements, as well as internal energy and enthalpy changes in chemical reactions.
Hess's Law: Hess's Law states that the total enthalpy change of a reaction is the same, regardless of the pathway taken, as long as the initial and final conditions are the same. This principle allows for the calculation of enthalpy changes in reactions that may be difficult to measure directly, emphasizing that enthalpy is a state function dependent only on the initial and final states of a system.
Joules: Joules are the SI unit of energy, defined as the amount of work done when a force of one newton is applied over a distance of one meter. This unit is crucial in understanding energy changes, especially in the context of reactions and thermodynamics, as it helps quantify the heat absorbed or released during chemical processes and is fundamental to calculating enthalpy changes using Hess's Law.
Julius Robert von Mayer: Julius Robert von Mayer was a German physician and physicist known for his contributions to the understanding of energy conservation and thermodynamics in the 19th century. He is particularly recognized for formulating the concept of energy conservation, which laid the groundwork for the first law of thermodynamics, directly influencing the study of enthalpy and reaction processes.
Kilojoules per mole: Kilojoules per mole (kJ/mol) is a unit of measurement used to express the energy change associated with a chemical reaction, specifically the amount of energy required or released per mole of a substance. This term is essential for quantifying the enthalpy changes in chemical reactions, allowing scientists to understand and compare the energetic favorability of different reactions.
Latent Heat: Latent heat is the amount of energy absorbed or released by a substance during a phase change without changing its temperature. This concept is crucial for understanding how internal energy and enthalpy are affected during processes like melting, boiling, and condensation. It highlights the relationship between heat transfer and changes in state, playing a key role in determining the enthalpy of reactions and the applications of Hess's Law.
Misunderstanding of signs in δh: Misunderstanding of signs in δh refers to the confusion that arises when interpreting the enthalpy change ($$\Delta h$$) associated with a chemical reaction, especially when considering whether a process is exothermic or endothermic. This misunderstanding can lead to incorrect conclusions about the energy changes involved in reactions, particularly when using Hess's Law to predict the enthalpy changes of overall reactions based on individual steps.
Standard Enthalpy of Formation: The standard enthalpy of formation is defined as the change in enthalpy when one mole of a compound is formed from its elements in their standard states at a specified temperature, typically 25°C (298 K), and 1 atm pressure. This value provides a reference point for calculating the enthalpy changes in chemical reactions and is crucial for understanding how energy is absorbed or released during reactions.
Thermochemical cycles: Thermochemical cycles are processes that describe the interconversion of heat and work in chemical reactions, allowing for the calculation of enthalpy changes through various pathways. These cycles utilize the principle that the total enthalpy change for a reaction is the same, regardless of the number of steps or the specific pathway taken to achieve it. By employing thermochemical cycles, one can understand how energy is absorbed or released during reactions, which is crucial for applying Hess's Law effectively.
δh = σδh(products) - σδh(reactants): This equation represents the change in enthalpy ( ext{δh}) during a chemical reaction, calculated as the sum of the enthalpy of the products minus the sum of the enthalpy of the reactants. It emphasizes that the total heat content change of a reaction can be derived from the individual enthalpies of each component involved. This principle connects to the broader concepts of thermodynamics, especially when applying Hess's Law to determine the heat changes in reactions where direct measurement isn't feasible.
© 2024 Fiveable Inc. All rights reserved.
AP® and SAT® are trademarks registered by the College Board, which is not affiliated with, and does not endorse this website.