Sum and difference identities let you find exact values of trig functions at angles that aren't on the standard unit circle (like 75° or 127π) by breaking them into angles you already know. They also serve as the foundation for double-angle formulas, half-angle formulas, and solving more complex trig equations.
Sum and Difference Formulas
The six core formulas
Notice the sign patterns here. For sine, the formula keeps the same sign as the operation (sum stays "+", difference stays "−"). For cosine, the sign flips (sum gets "−", difference gets "+"). For tangent, the numerator matches the operation's sign while the denominator flips.
Sine:
sin(A+B)=sinAcosB+cosAsinB
sin(A−B)=sinAcosB−cosAsinB
Cosine:
cos(A+B)=cosAcosB−sinAsinB
cos(A−B)=cosAcosB+sinAsinB
Tangent:
tan(A+B)=1−tanAtanBtanA+tanB
tan(A−B)=1+tanAtanBtanA−tanB
A quick way to remember: Sine formulas use a mix of Sine and Cosine (sin⋅cos), while Cosine formulas pair like with like (cos⋅cos and sin⋅sin).
Finding exact values with these formulas
The whole point is to decompose an unfamiliar angle into two familiar ones. For example, to find cos(75°):
Rewrite 75° as 45°+30°.
Apply the cosine sum formula: cos(45°+30°)=cos45°cos30°−sin45°sin30°
Substitute known values: =22⋅23−22⋅21
Simplify: =46−2
Common decompositions to keep in your back pocket:
75°=45°+30° and 15°=45°−30°
127π=3π+4π and 12π=3π−4π
105°=60°+45° and 125π=4π+6π
Cofunction identities from the difference formulas
Cofunction identities are actually a special case of the difference formulas. When you set A=2π and apply the difference formula, you get:
sin(2π−θ)=cosθ and cos(2π−θ)=sinθ
tan(2π−θ)=cotθ and cot(2π−θ)=tanθ
sec(2π−θ)=cscθ and csc(2π−θ)=secθ
Each pair involves complementary angles (angles that add to 2π, or 90°). When you see an expression like sin(2π−x) inside a larger problem, swap it for cosx right away to simplify your work.
Verification of trigonometric identities
To verify an identity means to show that both sides of an equation are equivalent for all values where they're defined. The strategy:
Pick the more complicated side (usually the LHS).
Expand any sum/difference expressions using the formulas above.
Apply cofunction identities or Pythagorean identities as needed.
Simplify using algebra (factor, combine fractions, cancel) until it matches the other side.
You should only manipulate one side at a time. Don't cross the equals sign and work on both sides simultaneously, since that assumes the identity is already true.
Example: Verify that sin(x+y)+sin(x−y)=2sinxcosy.
Expand the LHS using sum and difference formulas:
sin(x+y)=sinxcosy+cosxsiny
sin(x−y)=sinxcosy−cosxsiny
Add them: (sinxcosy+cosxsiny)+(sinxcosy−cosxsiny)
The cosxsiny terms cancel, leaving 2sinxcosy. This matches the RHS. ✓
Solving equations with identities
When a trig equation contains compound angles, use sum/difference formulas to rewrite everything in terms of a single angle.
Apply the appropriate sum or difference formula to expand compound-angle terms.
Substitute cofunction identities if any 2π−θ expressions appear.
Collect terms and solve using algebra (factoring, quadratic formula, etc.).
Find all solutions in the given domain. Remember: sine and cosine repeat every 2π, tangent and cotangent repeat every π.
Check your answers by plugging them back in. Factoring steps can sometimes introduce false solutions.
Simplification of complex expressions
When simplifying, look for these clues that a sum/difference formula applies:
You see sinAcosB±cosAsinB (that's a sine formula in disguise).
You see cosAcosB∓sinAsinB (that's a cosine formula).
You see a fraction with 1∓tanAtanBtanA±tanB (tangent formula).
Working backward from the expanded form back to the compact form is just as important as expanding. Many simplification problems ask you to recognize the pattern and condense.
Relationship to the unit circle
These identities come from the geometry of the unit circle. If you place two angles A and B on the unit circle, the cosine difference formula can be derived by computing the distance between the two corresponding points in two different ways. This geometric origin is why the formulas work for any angle, not just acute ones.
Applying Sum and Difference Identities
Solving equations with identities
Example: Solve sin(x+6π)=21 for 0≤x<2π.
You know sin(θ)=21 when θ=6π or θ=65π (plus multiples of 2π).
Set x+6π=6π, giving x=0.
Set x+6π=65π, giving x=65π−6π=32π.
Solutions: x=0 and x=32π.
Simplification of complex expressions
Example: Simplify tan(x+4π)−tan(x−4π).
Apply the tangent sum and difference formulas:
tan(x+4π)=1−tanxtanx+1
tan(x−4π)=1+tanxtanx−1
Subtract and find a common denominator (1−tanx)(1+tanx)=1−tan2x:
1−tan2x(tanx+1)(1+tanx)−(tanx−1)(1−tanx)
Note: The original guide listed the final answer as 2sec2x, but the denominator 1−tan2x doesn't simplify away. You can rewrite this as cos2x−sin2x2=cos(2x)2=2sec(2x), which is the fully simplified result.